About tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium
tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium (PubChem CID 173155873) has the molecular formula C10H12Zr
and a molecular weight of 223.43 g/mol. Its IUPAC name is tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium.
Molecular Properties
| Compound Name | tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium |
| PubChem CID | 173155873 |
| Molecular Formula | C10H12Zr |
| Molecular Weight | 223.43 g/mol |
| Exact Mass | 222.00 |
| IUPAC Name | tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium |
| SMILES | C1=CC2C3C=CC(C3)C2C1.[Zr] |
| InChI | InChI=1S/C10H12.Zr/c1-2-9-7-4-5-8(6-7)10(9)3-1;/h1-2,4-5,7-10H,3,6H2; |
| InChIKey | YOWMMAZZRYYLNY-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.43 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium?
The IUPAC name of tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium (CID 173155873) is tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium.
What is the SMILES notation for tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium?
The canonical SMILES for tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium is C1=CC2C3C=CC(C3)C2C1.[Zr].
What is the InChIKey of tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium?
The InChIKey is YOWMMAZZRYYLNY-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12.Zr/c1-2-9-7-4-5-8(6-7)10(9)3-1;/h1-2,4-5,7-10H,3,6H2;.
What are the key properties of tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium?
tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium has a molecular weight of 223.43 g/mol, XLogP of 2.38, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for tricyclo[5.2.1.02,6]deca-3,8-diene;zirconium is sourced from PubChem (CID 173155873), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).