About 1-ethynyl-2H-isoindole
1-ethynyl-2H-isoindole (PubChem CID 173155930) has the molecular formula C10H7N
and a molecular weight of 141.17 g/mol. Its IUPAC name is 1-ethynyl-2H-isoindole.
Molecular Properties
| Compound Name | 1-ethynyl-2H-isoindole |
| PubChem CID | 173155930 |
| Molecular Formula | C10H7N |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.06 |
| IUPAC Name | 1-ethynyl-2H-isoindole |
| SMILES | C#Cc1[nH]cc2ccccc12 |
| InChI | InChI=1S/C10H7N/c1-2-10-9-6-4-3-5-8(9)7-11-10/h1,3-7,11H |
| InChIKey | CAQJMFWUSGLZNZ-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-ethynyl-2H-isoindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-ethynyl-2H-isoindole?
The IUPAC name of 1-ethynyl-2H-isoindole (CID 173155930) is 1-ethynyl-2H-isoindole.
What is the SMILES notation for 1-ethynyl-2H-isoindole?
The canonical SMILES for 1-ethynyl-2H-isoindole is C#Cc1[nH]cc2ccccc12.
What is the InChIKey of 1-ethynyl-2H-isoindole?
The InChIKey is CAQJMFWUSGLZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7N/c1-2-10-9-6-4-3-5-8(9)7-11-10/h1,3-7,11H.
What are the key properties of 1-ethynyl-2H-isoindole?
1-ethynyl-2H-isoindole has a molecular weight of 141.17 g/mol, XLogP of 2.15, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethynyl-2H-isoindole is sourced from PubChem (CID 173155930), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).