About azane;fluoro(methoxy)borinic acid
azane;fluoro(methoxy)borinic acid (PubChem CID 173155946) has the molecular formula CH7BFNO2
and a molecular weight of 94.88 g/mol. Its IUPAC name is azane;fluoro(methoxy)borinic acid.
Molecular Properties
| Compound Name | azane;fluoro(methoxy)borinic acid |
| PubChem CID | 173155946 |
| Molecular Formula | CH7BFNO2 |
| Molecular Weight | 94.88 g/mol |
| Exact Mass | 95.06 |
| IUPAC Name | azane;fluoro(methoxy)borinic acid |
| SMILES | COB(O)F.N |
| InChI | InChI=1S/CH4BFO2.H3N/c1-5-2(3)4;/h4H,1H3;1H3 |
| InChIKey | VSNLFUXXDSJDER-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 64.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 94.88 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze azane;fluoro(methoxy)borinic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;fluoro(methoxy)borinic acid?
The IUPAC name of azane;fluoro(methoxy)borinic acid (CID 173155946) is azane;fluoro(methoxy)borinic acid.
What is the SMILES notation for azane;fluoro(methoxy)borinic acid?
The canonical SMILES for azane;fluoro(methoxy)borinic acid is COB(O)F.N.
What is the InChIKey of azane;fluoro(methoxy)borinic acid?
The InChIKey is VSNLFUXXDSJDER-UHFFFAOYSA-N. The full InChI is InChI=1S/CH4BFO2.H3N/c1-5-2(3)4;/h4H,1H3;1H3.
What are the key properties of azane;fluoro(methoxy)borinic acid?
azane;fluoro(methoxy)borinic acid has a molecular weight of 94.88 g/mol, XLogP of -0.26, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;fluoro(methoxy)borinic acid is sourced from PubChem (CID 173155946), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).