C38H36N4O — CID 173156277
(5Z,14Z,19Z)-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-1,4,21,22-tetrahydroporphyrin-2-one (PubChem CID 173156277) has the molecular formula C38H36N4O and a molecular weight of 564.73 g/mol. Its IUPAC name is (5Z,14Z,19Z)-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-1,4,21,22-tetrahydroporphyrin-2-one.
| Compound Name | (5Z,14Z,19Z)-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-1,4,21,22-tetrahydroporphyrin-2-one |
|---|---|
| PubChem CID | 173156277 |
| Molecular Formula | C38H36N4O |
| Molecular Weight | 564.73 g/mol |
| Exact Mass | 564.29 |
| IUPAC Name | (5Z,14Z,19Z)-3,3-dimethyl-10-(4-methylphenyl)-15-(2,4,6-trimethylphenyl)-1,4,21,22-tetrahydroporphyrin-2-one |
| SMILES | Cc1ccc(C2=c3cc/c([nH]3)=C/C3NC(/C=C4/C=CC(=N4)/C(c4c(C)cc(C)cc4C)=C4/C=CC2=N4)C(=O)C3(C)C)cc1 |
| InChI | InChI=1S/C38H36N4O/c1-21-7-9-25(10-8-21)35-28-13-12-27(40-28)20-33-38(5,6)37(43)32(42-33)19-26-11-14-30(39-26)36(31-16-15-29(35)41-31)34-23(3)17-22(2)18-24(34)4/h7-20,32-33,40,42H,1-6H3/b26-19-,27-20-,35-28?,36-31+ |
| InChIKey | AMRLRWOLOMFSRM-DALYXGTASA-N |
| XLogP | 5.49 |
| TPSA | 69.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.73 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |