C42H46Zr — CID 173156446
CID 173156446 (PubChem CID 173156446) has the molecular formula C42H46Zr and a molecular weight of 642.05 g/mol.
| Compound Name | CID 173156446 |
|---|---|
| PubChem CID | 173156446 |
| Molecular Formula | C42H46Zr |
| Molecular Weight | 642.05 g/mol |
| Exact Mass | 640.26 |
| IUPAC Name | — |
| SMILES | CC(=[Zr+2])c1ccccc1.CC1(C)C=Cc2cc3c(cc21)[cH-]c1cc2c(cc13)C=CC2(C)C.CCC1[C-]=CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C23H21.C11H17.C8H8.Zr/c1-22(2)7-5-14-10-18-16(12-20(14)22)9-17-13-21-15(11-19(17)18)6-8-23(21,3)4;1-5-9-6-7-10(8-9)11(2,3)4;1-2-8-6-4-3-5-7-8;/h5-13H,1-4H3;7-9H,5H2,1-4H3;3-7H,1H3;/q2*-1;;+2 |
| InChIKey | RFRYVHACCPULGV-UHFFFAOYSA-N |
| XLogP | 11.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 642.05 |
| LogP ≤ 5 | 11.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|