About N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride
N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride (PubChem CID 173157305) has the molecular formula C2H9Cl2NOSiTi
and a molecular weight of 209.96 g/mol. Its IUPAC name is N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride.
Molecular Properties
| Compound Name | N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride |
| PubChem CID | 173157305 |
| Molecular Formula | C2H9Cl2NOSiTi |
| Molecular Weight | 209.96 g/mol |
| Exact Mass | 208.93 |
| IUPAC Name | N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride |
| SMILES | CN(C)[SiH]=O.Cl.Cl.[Ti] |
| InChI | InChI=1S/C2H7NOSi.2ClH.Ti/c1-3(2)5-4;;;/h5H,1-2H3;2*1H; |
| InChIKey | MAKHXYCGNSDCIY-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.96 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride?
The IUPAC name of N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride (CID 173157305) is N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride.
What is the SMILES notation for N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride?
The canonical SMILES for N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride is CN(C)[SiH]=O.Cl.Cl.[Ti].
What is the InChIKey of N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride?
The InChIKey is MAKHXYCGNSDCIY-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NOSi.2ClH.Ti/c1-3(2)5-4;;;/h5H,1-2H3;2*1H;.
What are the key properties of N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride?
N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride has a molecular weight of 209.96 g/mol, XLogP of 0.09, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-oxosilylmethanamine;titanium;dihydrochloride is sourced from PubChem (CID 173157305), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).