C15H34BrN — CID 173157515
3,4-diethylundecan-3-amine;hydrobromide (PubChem CID 173157515) has the molecular formula C15H34BrN and a molecular weight of 308.35 g/mol. Its IUPAC name is 3,4-diethylundecan-3-amine;hydrobromide.
| Compound Name | 3,4-diethylundecan-3-amine;hydrobromide |
|---|---|
| PubChem CID | 173157515 |
| Molecular Formula | C15H34BrN |
| Molecular Weight | 308.35 g/mol |
| Exact Mass | 307.19 |
| IUPAC Name | 3,4-diethylundecan-3-amine;hydrobromide |
| SMILES | Br.CCCCCCCC(CC)C(N)(CC)CC |
| InChI | InChI=1S/C15H33N.BrH/c1-5-9-10-11-12-13-14(6-2)15(16,7-3)8-4;/h14H,5-13,16H2,1-4H3;1H |
| InChIKey | UFXRXWOFHQUSMJ-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.35 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|