About (2,3,4-trimethylphenyl)phosphane;hydrochloride
(2,3,4-trimethylphenyl)phosphane;hydrochloride (PubChem CID 173157555) has the molecular formula C9H14ClP
and a molecular weight of 188.64 g/mol. Its IUPAC name is (2,3,4-trimethylphenyl)phosphane;hydrochloride.
Molecular Properties
| Compound Name | (2,3,4-trimethylphenyl)phosphane;hydrochloride |
| PubChem CID | 173157555 |
| Molecular Formula | C9H14ClP |
| Molecular Weight | 188.64 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (2,3,4-trimethylphenyl)phosphane;hydrochloride |
| SMILES | Cc1ccc(P)c(C)c1C.Cl |
| InChI | InChI=1S/C9H13P.ClH/c1-6-4-5-9(10)8(3)7(6)2;/h4-5H,10H2,1-3H3;1H |
| InChIKey | GZQCSYQIWXZSCJ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (2,3,4-trimethylphenyl)phosphane;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,3,4-trimethylphenyl)phosphane;hydrochloride?
The IUPAC name of (2,3,4-trimethylphenyl)phosphane;hydrochloride (CID 173157555) is (2,3,4-trimethylphenyl)phosphane;hydrochloride.
What is the SMILES notation for (2,3,4-trimethylphenyl)phosphane;hydrochloride?
The canonical SMILES for (2,3,4-trimethylphenyl)phosphane;hydrochloride is Cc1ccc(P)c(C)c1C.Cl.
What is the InChIKey of (2,3,4-trimethylphenyl)phosphane;hydrochloride?
The InChIKey is GZQCSYQIWXZSCJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13P.ClH/c1-6-4-5-9(10)8(3)7(6)2;/h4-5H,10H2,1-3H3;1H.
What are the key properties of (2,3,4-trimethylphenyl)phosphane;hydrochloride?
(2,3,4-trimethylphenyl)phosphane;hydrochloride has a molecular weight of 188.64 g/mol, XLogP of 2.53, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,3,4-trimethylphenyl)phosphane;hydrochloride is sourced from PubChem (CID 173157555), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).