About 7-hexyltridecan-7-ylphosphane;hydrobromide
7-hexyltridecan-7-ylphosphane;hydrobromide (PubChem CID 173158553) has the molecular formula C19H42BrP
and a molecular weight of 381.42 g/mol. Its IUPAC name is 7-hexyltridecan-7-ylphosphane;hydrobromide.
Molecular Properties
| Compound Name | 7-hexyltridecan-7-ylphosphane;hydrobromide |
| PubChem CID | 173158553 |
| Molecular Formula | C19H42BrP |
| Molecular Weight | 381.42 g/mol |
| Exact Mass | 380.22 |
| IUPAC Name | 7-hexyltridecan-7-ylphosphane;hydrobromide |
| SMILES | Br.CCCCCCC(P)(CCCCCC)CCCCCC |
| InChI | InChI=1S/C19H41P.BrH/c1-4-7-10-13-16-19(20,17-14-11-8-5-2)18-15-12-9-6-3;/h4-18,20H2,1-3H3;1H |
| InChIKey | MMYDHZJLGGVCSC-UHFFFAOYSA-N |
| XLogP | 8.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 381.42 |
| LogP ≤ 5 | 8.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 7-hexyltridecan-7-ylphosphane;hydrobromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-hexyltridecan-7-ylphosphane;hydrobromide?
The IUPAC name of 7-hexyltridecan-7-ylphosphane;hydrobromide (CID 173158553) is 7-hexyltridecan-7-ylphosphane;hydrobromide.
What is the SMILES notation for 7-hexyltridecan-7-ylphosphane;hydrobromide?
The canonical SMILES for 7-hexyltridecan-7-ylphosphane;hydrobromide is Br.CCCCCCC(P)(CCCCCC)CCCCCC.
What is the InChIKey of 7-hexyltridecan-7-ylphosphane;hydrobromide?
The InChIKey is MMYDHZJLGGVCSC-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41P.BrH/c1-4-7-10-13-16-19(20,17-14-11-8-5-2)18-15-12-9-6-3;/h4-18,20H2,1-3H3;1H.
What are the key properties of 7-hexyltridecan-7-ylphosphane;hydrobromide?
7-hexyltridecan-7-ylphosphane;hydrobromide has a molecular weight of 381.42 g/mol, XLogP of 8.09, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 7-hexyltridecan-7-ylphosphane;hydrobromide is sourced from PubChem (CID 173158553), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).