C11H11N3O4S — CID 173159538
1-carbamoyl-6-cyano-3,4-dihydro-2H-quinoline-4-sulfonic acid (PubChem CID 173159538) has the molecular formula C11H11N3O4S and a molecular weight of 281.29 g/mol. Its IUPAC name is 1-carbamoyl-6-cyano-3,4-dihydro-2H-quinoline-4-sulfonic acid.
| Compound Name | 1-carbamoyl-6-cyano-3,4-dihydro-2H-quinoline-4-sulfonic acid |
|---|---|
| PubChem CID | 173159538 |
| Molecular Formula | C11H11N3O4S |
| Molecular Weight | 281.29 g/mol |
| Exact Mass | 281.05 |
| IUPAC Name | 1-carbamoyl-6-cyano-3,4-dihydro-2H-quinoline-4-sulfonic acid |
| SMILES | N#Cc1ccc2c(c1)C(S(=O)(=O)O)CCN2C(N)=O |
| InChI | InChI=1S/C11H11N3O4S/c12-6-7-1-2-9-8(5-7)10(19(16,17)18)3-4-14(9)11(13)15/h1-2,5,10H,3-4H2,(H2,13,15)(H,16,17,18) |
| InChIKey | ZPCVTMBWMXFDDI-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 124.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.29 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|