C27H27AsN2O4 — CID 173160105
(2R)-1-[4-[4-[(2,6-dimethylphenyl)carbamoylarsanyl]phenyl]benzoyl]pyrrolidine-2-carboxylic acid (PubChem CID 173160105) has the molecular formula C27H27AsN2O4 and a molecular weight of 518.45 g/mol. Its IUPAC name is (2R)-1-[4-[4-[(2,6-dimethylphenyl)carbamoylarsanyl]phenyl]benzoyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-[4-[(2,6-dimethylphenyl)carbamoylarsanyl]phenyl]benzoyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 173160105 |
| Molecular Formula | C27H27AsN2O4 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 518.12 |
| IUPAC Name | (2R)-1-[4-[4-[(2,6-dimethylphenyl)carbamoylarsanyl]phenyl]benzoyl]pyrrolidine-2-carboxylic acid |
| SMILES | Cc1cccc(C)c1NC(=O)[AsH]c1ccc(-c2ccc(C(=O)N3CCC[C@@H]3C(=O)O)cc2)cc1 |
| InChI | InChI=1S/C27H27AsN2O4/c1-17-5-3-6-18(2)24(17)29-27(34)28-22-14-12-20(13-15-22)19-8-10-21(11-9-19)25(31)30-16-4-7-23(30)26(32)33/h3,5-6,8-15,23,28H,4,7,16H2,1-2H3,(H,29,34)(H,32,33)/t23-/m1/s1 |
| InChIKey | FZCWCMMNHSNUDI-HSZRJFAPSA-N |
| XLogP | 3.95 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|