C22H34 — CID 173160476
(8S,9S,13R,14S,17S)-17-butyl-13-methyl-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene (PubChem CID 173160476) has the molecular formula C22H34 and a molecular weight of 298.51 g/mol. Its IUPAC name is (8S,9S,13R,14S,17S)-17-butyl-13-methyl-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene.
| Compound Name | (8S,9S,13R,14S,17S)-17-butyl-13-methyl-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
|---|---|
| PubChem CID | 173160476 |
| Molecular Formula | C22H34 |
| Molecular Weight | 298.51 g/mol |
| Exact Mass | 298.27 |
| IUPAC Name | (8S,9S,13R,14S,17S)-17-butyl-13-methyl-1,4,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthrene |
| SMILES | CCCC[C@H]1CC[C@H]2[C@@H]3CCC4=C(CC=CC4)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C22H34/c1-3-4-8-17-11-13-21-20-12-10-16-7-5-6-9-18(16)19(20)14-15-22(17,21)2/h5-6,17,19-21H,3-4,7-15H2,1-2H3/t17-,19+,20+,21-,22+/m0/s1 |
| InChIKey | RBDVXQGGPHWPQY-KMHBYZIFSA-N |
| XLogP | 6.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.51 |
| LogP ≤ 5 | 6.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|