C41H52Zr — CID 173160689
2-tert-butyl-5-propylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylethylidenezirconium(2+) (PubChem CID 173160689) has the molecular formula C41H52Zr and a molecular weight of 636.09 g/mol. Its IUPAC name is 2-tert-butyl-5-propylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylethylidenezirconium(2+).
| Compound Name | 2-tert-butyl-5-propylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylethylidenezirconium(2+) |
|---|---|
| PubChem CID | 173160689 |
| Molecular Formula | C41H52Zr |
| Molecular Weight | 636.09 g/mol |
| Exact Mass | 634.31 |
| IUPAC Name | 2-tert-butyl-5-propylcyclopenta-1,3-diene;2,7-ditert-butyl-1,9-dihydrofluoren-1-ide;1-phenylethylidenezirconium(2+) |
| SMILES | CC(=[Zr+2])c1ccccc1.CC(C)(C)c1[c-]c2c(cc1)-c1ccc(C(C)(C)C)cc1C2.CCCC1[C-]=CC(C(C)(C)C)=C1 |
| InChI | InChI=1S/C21H25.C12H19.C8H8.Zr/c1-20(2,3)16-7-9-18-14(12-16)11-15-13-17(21(4,5)6)8-10-19(15)18;1-5-6-10-7-8-11(9-10)12(2,3)4;1-2-8-6-4-3-5-7-8;/h7-10,12H,11H2,1-6H3;8-10H,5-6H2,1-4H3;3-7H,1H3;/q2*-1;;+2 |
| InChIKey | YKRZBZSDNWPBNE-UHFFFAOYSA-N |
| XLogP | 11.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.09 |
| LogP ≤ 5 | 11.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|