About but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile
but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile (PubChem CID 173160707) has the molecular formula C13H17N3
and a molecular weight of 215.30 g/mol. Its IUPAC name is but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile.
Molecular Properties
| Compound Name | but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile |
| PubChem CID | 173160707 |
| Molecular Formula | C13H17N3 |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.14 |
| IUPAC Name | but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile |
| SMILES | C=C(C)C#N.CC=CC#N.CCC=CC#N |
| InChI | InChI=1S/C5H7N.2C4H5N/c1-2-3-4-5-6;1-4(2)3-5;1-2-3-4-5/h3-4H,2H2,1H3;1H2,2H3;2-3H,1H3 |
| InChIKey | TYTYQEUBLDNGNV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 71.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile?
The IUPAC name of but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile (CID 173160707) is but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile.
What is the SMILES notation for but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile?
The canonical SMILES for but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile is C=C(C)C#N.CC=CC#N.CCC=CC#N.
What is the InChIKey of but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile?
The InChIKey is TYTYQEUBLDNGNV-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H7N.2C4H5N/c1-2-3-4-5-6;1-4(2)3-5;1-2-3-4-5/h3-4H,2H2,1H3;1H2,2H3;2-3H,1H3.
What are the key properties of but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile?
but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile has a molecular weight of 215.30 g/mol, XLogP of 3.65, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for but-2-enenitrile;2-methylprop-2-enenitrile;pent-2-enenitrile is sourced from PubChem (CID 173160707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).