C57H60Zr — CID 173160715
bis(4-methylphenyl)methylidenezirconium(2+);2,7-bis(2,4,6-trimethylphenyl)-9H-fluoren-9-ide;2-tert-butyl-5-ethylcyclopenta-1,3-diene (PubChem CID 173160715) has the molecular formula C57H60Zr and a molecular weight of 836.33 g/mol. Its IUPAC name is bis(4-methylphenyl)methylidenezirconium(2+);2,7-bis(2,4,6-trimethylphenyl)-9H-fluoren-9-ide;2-tert-butyl-5-ethylcyclopenta-1,3-diene.
| Compound Name | bis(4-methylphenyl)methylidenezirconium(2+);2,7-bis(2,4,6-trimethylphenyl)-9H-fluoren-9-ide;2-tert-butyl-5-ethylcyclopenta-1,3-diene |
|---|---|
| PubChem CID | 173160715 |
| Molecular Formula | C57H60Zr |
| Molecular Weight | 836.33 g/mol |
| Exact Mass | 834.37 |
| IUPAC Name | bis(4-methylphenyl)methylidenezirconium(2+);2,7-bis(2,4,6-trimethylphenyl)-9H-fluoren-9-ide;2-tert-butyl-5-ethylcyclopenta-1,3-diene |
| SMILES | CCC1[C-]=CC(C(C)(C)C)=C1.Cc1cc(C)c(-c2ccc3c(c2)[cH-]c2cc(-c4c(C)cc(C)cc4C)ccc23)c(C)c1.Cc1ccc(C(=[Zr+2])c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C31H29.C15H14.C11H17.Zr/c1-18-11-20(3)30(21(4)12-18)24-7-9-28-26(15-24)17-27-16-25(8-10-29(27)28)31-22(5)13-19(2)14-23(31)6;1-12-3-7-14(8-4-12)11-15-9-5-13(2)6-10-15;1-5-9-6-7-10(8-9)11(2,3)4;/h7-17H,1-6H3;3-10H,1-2H3;7-9H,5H2,1-4H3;/q-1;;-1;+2 |
| InChIKey | LAPCPYGEQIUTSG-UHFFFAOYSA-N |
| XLogP | 15.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 836.33 |
| LogP ≤ 5 | 15.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|