C12H23N3O4 — CID 173160766
[2,2-dimethyl-3-oxo-3-(4-propylpiperazin-1-yl)propyl] nitrate (PubChem CID 173160766) has the molecular formula C12H23N3O4 and a molecular weight of 273.33 g/mol. Its IUPAC name is [2,2-dimethyl-3-oxo-3-(4-propylpiperazin-1-yl)propyl] nitrate.
| Compound Name | [2,2-dimethyl-3-oxo-3-(4-propylpiperazin-1-yl)propyl] nitrate |
|---|---|
| PubChem CID | 173160766 |
| Molecular Formula | C12H23N3O4 |
| Molecular Weight | 273.33 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | [2,2-dimethyl-3-oxo-3-(4-propylpiperazin-1-yl)propyl] nitrate |
| SMILES | CCCN1CCN(C(=O)C(C)(C)CO[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C12H23N3O4/c1-4-5-13-6-8-14(9-7-13)11(16)12(2,3)10-19-15(17)18/h4-10H2,1-3H3 |
| InChIKey | OHVGYZIMHZJVHD-UHFFFAOYSA-N |
| XLogP | 0.78 |
| TPSA | 75.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.33 |
| LogP ≤ 5 | 0.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|