About azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride
azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride (PubChem CID 173161241) has the molecular formula C10H21ClN2O2
and a molecular weight of 236.74 g/mol. Its IUPAC name is azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride.
Molecular Properties
| Compound Name | azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride |
| PubChem CID | 173161241 |
| Molecular Formula | C10H21ClN2O2 |
| Molecular Weight | 236.74 g/mol |
| Exact Mass | 236.13 |
| IUPAC Name | azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride |
| SMILES | C=CCNCCC(=CC)C(=O)OC.Cl.N |
| InChI | InChI=1S/C10H17NO2.ClH.H3N/c1-4-7-11-8-6-9(5-2)10(12)13-3;;/h4-5,11H,1,6-8H2,2-3H3;1H;1H3 |
| InChIKey | WNSGIVPGLCNQKM-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 73.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 236.74 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride?
The IUPAC name of azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride (CID 173161241) is azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride.
What is the SMILES notation for azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride?
The canonical SMILES for azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride is C=CCNCCC(=CC)C(=O)OC.Cl.N.
What is the InChIKey of azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride?
The InChIKey is WNSGIVPGLCNQKM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H17NO2.ClH.H3N/c1-4-7-11-8-6-9(5-2)10(12)13-3;;/h4-5,11H,1,6-8H2,2-3H3;1H;1H3.
What are the key properties of azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride?
azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride has a molecular weight of 236.74 g/mol, XLogP of 1.86, 6 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for azane;methyl 2-[2-(prop-2-enylamino)ethyl]but-2-enoate;hydrochloride is sourced from PubChem (CID 173161241), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).