About 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole
5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole (PubChem CID 173161916) has the molecular formula C15H15NO4S2
and a molecular weight of 337.42 g/mol. Its IUPAC name is 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole |
| PubChem CID | 173161916 |
| Molecular Formula | C15H15NO4S2 |
| Molecular Weight | 337.42 g/mol |
| Exact Mass | 337.04 |
| IUPAC Name | 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole |
| SMILES | Cc1ccc(O)cc1S(=O)(=O)O.Cc1nc2ccccc2s1 |
| InChI | InChI=1S/C8H7NS.C7H8O4S/c1-6-9-7-4-2-3-5-8(7)10-6;1-5-2-3-6(8)4-7(5)12(9,10)11/h2-5H,1H3;2-4,8H,1H3,(H,9,10,11) |
| InChIKey | ITYFCZICFNRMRD-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 337.42 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole?
The IUPAC name of 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole (CID 173161916) is 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole.
What is the SMILES notation for 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole?
The canonical SMILES for 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole is Cc1ccc(O)cc1S(=O)(=O)O.Cc1nc2ccccc2s1.
What is the InChIKey of 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole?
The InChIKey is ITYFCZICFNRMRD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7NS.C7H8O4S/c1-6-9-7-4-2-3-5-8(7)10-6;1-5-2-3-6(8)4-7(5)12(9,10)11/h2-5H,1H3;2-4,8H,1H3,(H,9,10,11).
What are the key properties of 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole?
5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole has a molecular weight of 337.42 g/mol, XLogP of 3.55, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-hydroxy-2-methylbenzenesulfonic acid;2-methyl-1,3-benzothiazole is sourced from PubChem (CID 173161916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).