About phthalazin-1-yl methanesulfonate
phthalazin-1-yl methanesulfonate (PubChem CID 173162760) has the molecular formula C9H8N2O3S
and a molecular weight of 224.24 g/mol. Its IUPAC name is phthalazin-1-yl methanesulfonate.
Molecular Properties
| Compound Name | phthalazin-1-yl methanesulfonate |
| PubChem CID | 173162760 |
| Molecular Formula | C9H8N2O3S |
| Molecular Weight | 224.24 g/mol |
| Exact Mass | 224.03 |
| IUPAC Name | phthalazin-1-yl methanesulfonate |
| SMILES | CS(=O)(=O)Oc1nncc2ccccc12 |
| InChI | InChI=1S/C9H8N2O3S/c1-15(12,13)14-9-8-5-3-2-4-7(8)6-10-11-9/h2-6H,1H3 |
| InChIKey | BIDZEMDFEDZINN-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 69.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 224.24 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze phthalazin-1-yl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of phthalazin-1-yl methanesulfonate?
The IUPAC name of phthalazin-1-yl methanesulfonate (CID 173162760) is phthalazin-1-yl methanesulfonate.
What is the SMILES notation for phthalazin-1-yl methanesulfonate?
The canonical SMILES for phthalazin-1-yl methanesulfonate is CS(=O)(=O)Oc1nncc2ccccc12.
What is the InChIKey of phthalazin-1-yl methanesulfonate?
The InChIKey is BIDZEMDFEDZINN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8N2O3S/c1-15(12,13)14-9-8-5-3-2-4-7(8)6-10-11-9/h2-6H,1H3.
What are the key properties of phthalazin-1-yl methanesulfonate?
phthalazin-1-yl methanesulfonate has a molecular weight of 224.24 g/mol, XLogP of 0.97, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for phthalazin-1-yl methanesulfonate is sourced from PubChem (CID 173162760), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).