C21H25N3O3 — CID 173163662
(3aS)-2-(furan-3-carbonyl)-5-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-4-carboxamide (PubChem CID 173163662) has the molecular formula C21H25N3O3 and a molecular weight of 367.45 g/mol. Its IUPAC name is (3aS)-2-(furan-3-carbonyl)-5-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-4-carboxamide.
| Compound Name | (3aS)-2-(furan-3-carbonyl)-5-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-4-carboxamide |
|---|---|
| PubChem CID | 173163662 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | (3aS)-2-(furan-3-carbonyl)-5-(3-phenylpropyl)-1,3,3a,4,6,6a-hexahydropyrrolo[3,4-c]pyrrole-4-carboxamide |
| SMILES | NC(=O)C1[C@@H]2CN(C(=O)c3ccoc3)CC2CN1CCCc1ccccc1 |
| InChI | InChI=1S/C21H25N3O3/c22-20(25)19-18-13-24(21(26)16-8-10-27-14-16)12-17(18)11-23(19)9-4-7-15-5-2-1-3-6-15/h1-3,5-6,8,10,14,17-19H,4,7,9,11-13H2,(H2,22,25)/t17?,18-,19?/m1/s1 |
| InChIKey | OKBSPGOSTLVBNF-JLAWEPINSA-N |
| XLogP | 1.77 |
| TPSA | 79.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |