About CID 173165287
CID 173165287 (PubChem CID 173165287) has the molecular formula C3Cl8Tl
and a molecular weight of 524.04 g/mol.
Molecular Properties
| Compound Name | CID 173165287 |
| PubChem CID | 173165287 |
| Molecular Formula | C3Cl8Tl |
| Molecular Weight | 524.04 g/mol |
| Exact Mass | 520.73 |
| IUPAC Name | — |
| SMILES | ClC(Cl)(Cl)Cl.ClC1(Cl)[Tl]C1(Cl)Cl |
| InChI | InChI=1S/C2Cl4.CCl4.Tl/c3-1(4)2(5)6;2-1(3,4)5; |
| InChIKey | MYLQTMNMPYGSQN-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 524.04 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze CID 173165287 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173165287?
The IUPAC name of CID 173165287 (CID 173165287) is not available.
What is the SMILES notation for CID 173165287?
The canonical SMILES for CID 173165287 is ClC(Cl)(Cl)Cl.ClC1(Cl)[Tl]C1(Cl)Cl.
What is the InChIKey of CID 173165287?
The InChIKey is MYLQTMNMPYGSQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C2Cl4.CCl4.Tl/c3-1(4)2(5)6;2-1(3,4)5;.
What are the key properties of CID 173165287?
CID 173165287 has a molecular weight of 524.04 g/mol, XLogP of 4.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173165287 is sourced from PubChem (CID 173165287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).