About sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid
sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid (PubChem CID 173165634) has the molecular formula C7H16NNaO10S2
and a molecular weight of 361.33 g/mol. Its IUPAC name is sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid.
Molecular Properties
| Compound Name | sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid |
| PubChem CID | 173165634 |
| Molecular Formula | C7H16NNaO10S2 |
| Molecular Weight | 361.33 g/mol |
| Exact Mass | 361.01 |
| IUPAC Name | sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid |
| SMILES | O=[N+]([O-])C(CCCS(=O)(=O)OO)CCCS(=O)(=O)OO.[H-].[Na+] |
| InChI | InChI=1S/C7H15NO10S2.Na.H/c9-8(10)7(3-1-5-19(13,14)17-11)4-2-6-20(15,16)18-12;;/h7,11-12H,1-6H2;;/q;+1;-1 |
| InChIKey | FTERBEICDLSZKT-UHFFFAOYSA-N |
| XLogP | -3.05 |
| TPSA | 170.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.33 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|
Analyze sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid?
The IUPAC name of sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid (CID 173165634) is sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid.
What is the SMILES notation for sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid?
The canonical SMILES for sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid is O=[N+]([O-])C(CCCS(=O)(=O)OO)CCCS(=O)(=O)OO.[H-].[Na+].
What is the InChIKey of sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid?
The InChIKey is FTERBEICDLSZKT-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H15NO10S2.Na.H/c9-8(10)7(3-1-5-19(13,14)17-11)4-2-6-20(15,16)18-12;;/h7,11-12H,1-6H2;;/q;+1;-1.
What are the key properties of sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid?
sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid has a molecular weight of 361.33 g/mol, XLogP of -3.05, 11 rotatable bonds, 2 hydrogen bond donors, and 10 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;hydride;4-nitroheptane-1,7-disulfonoperoxoic acid is sourced from PubChem (CID 173165634), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).