C21H30N3O7S2+ — CID 173165828
1-[4-[[(4-hydroxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-4,5-disulfonic acid (PubChem CID 173165828) has the molecular formula C21H30N3O7S2+ and a molecular weight of 500.62 g/mol. Its IUPAC name is 1-[4-[[(4-hydroxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-4,5-disulfonic acid.
| Compound Name | 1-[4-[[(4-hydroxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-4,5-disulfonic acid |
|---|---|
| PubChem CID | 173165828 |
| Molecular Formula | C21H30N3O7S2+ |
| Molecular Weight | 500.62 g/mol |
| Exact Mass | 500.15 |
| IUPAC Name | 1-[4-[[(4-hydroxyphenyl)-methylhydrazinylidene]methyl]pyridin-1-ium-1-yl]octane-4,5-disulfonic acid |
| SMILES | CCCC(C(CCC[n+]1ccc(C=NN(C)c2ccc(O)cc2)cc1)S(=O)(=O)O)S(=O)(=O)O |
| InChI | InChI=1S/C21H29N3O7S2/c1-3-5-20(32(26,27)28)21(33(29,30)31)6-4-13-24-14-11-17(12-15-24)16-22-23(2)18-7-9-19(25)10-8-18/h7-12,14-16,20-21H,3-6,13H2,1-2H3,(H2-,22,25,26,27,28,29,30,31)/p+1 |
| InChIKey | KEZFPXWHUHGUHO-UHFFFAOYSA-O |
| XLogP | 2.24 |
| TPSA | 148.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.62 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|