About [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate
[methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate (PubChem CID 173166009) has the molecular formula C11H14N3O5P
and a molecular weight of 299.22 g/mol. Its IUPAC name is [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate.
Molecular Properties
| Compound Name | [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate |
| PubChem CID | 173166009 |
| Molecular Formula | C11H14N3O5P |
| Molecular Weight | 299.22 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate |
| SMILES | CC(=O)ON(C)C(N)=NP1(=O)OCc2ccccc2O1 |
| InChI | InChI=1S/C11H14N3O5P/c1-8(15)18-14(2)11(12)13-20(16)17-7-9-5-3-4-6-10(9)19-20/h3-6H,7H2,1-2H3,(H2,12,13,16) |
| InChIKey | HMEIOCDYHROZKP-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 103.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.22 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate?
The IUPAC name of [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate (CID 173166009) is [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate.
What is the SMILES notation for [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate?
The canonical SMILES for [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate is CC(=O)ON(C)C(N)=NP1(=O)OCc2ccccc2O1.
What is the InChIKey of [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate?
The InChIKey is HMEIOCDYHROZKP-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14N3O5P/c1-8(15)18-14(2)11(12)13-20(16)17-7-9-5-3-4-6-10(9)19-20/h3-6H,7H2,1-2H3,(H2,12,13,16).
What are the key properties of [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate?
[methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate has a molecular weight of 299.22 g/mol, XLogP of 1.43, 1 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [methyl-[N'-(2-oxo-4H-1,3,2λ5-benzodioxaphosphinin-2-yl)carbamimidoyl]amino] acetate is sourced from PubChem (CID 173166009), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).