About 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal
2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal (PubChem CID 173166523) has the molecular formula C18H11F3O2
and a molecular weight of 316.28 g/mol. Its IUPAC name is 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal.
Molecular Properties
| Compound Name | 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal |
| PubChem CID | 173166523 |
| Molecular Formula | C18H11F3O2 |
| Molecular Weight | 316.28 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal |
| SMILES | O=CC(=Cc1ccccc1)C(=O)C(F)=C(F)c1ccccc1F |
| InChI | InChI=1S/C18H11F3O2/c19-15-9-5-4-8-14(15)16(20)17(21)18(23)13(11-22)10-12-6-2-1-3-7-12/h1-11H |
| InChIKey | QUKZXDAHQDBQQU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.28 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal?
The IUPAC name of 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal (CID 173166523) is 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal.
What is the SMILES notation for 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal?
The canonical SMILES for 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal is O=CC(=Cc1ccccc1)C(=O)C(F)=C(F)c1ccccc1F.
What is the InChIKey of 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal?
The InChIKey is QUKZXDAHQDBQQU-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H11F3O2/c19-15-9-5-4-8-14(15)16(20)17(21)18(23)13(11-22)10-12-6-2-1-3-7-12/h1-11H.
What are the key properties of 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal?
2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal has a molecular weight of 316.28 g/mol, XLogP of 4.28, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylidene-4,5-difluoro-5-(2-fluorophenyl)-3-oxopent-4-enal is sourced from PubChem (CID 173166523), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).