About dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide
dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide (PubChem CID 173167379) has the molecular formula C18H19Cl2SiZr-
and a molecular weight of 425.57 g/mol. Its IUPAC name is dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide |
| PubChem CID | 173167379 |
| Molecular Formula | C18H19Cl2SiZr- |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 422.97 |
| IUPAC Name | dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide |
| SMILES | C[Si](C)=[Zr](Cl)Cl.Cc1cc2c(-c3ccccc3)cccc2[cH-]1 |
| InChI | InChI=1S/C16H13.C2H6Si.2ClH.Zr/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;1-3-2;;;/h2-11H,1H3;1-2H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | PVXFVBLPXRECSN-UHFFFAOYSA-L |
| XLogP | 6.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 6.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide?
The IUPAC name of dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide (CID 173167379) is dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide.
What is the SMILES notation for dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide?
The canonical SMILES for dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide is C[Si](C)=[Zr](Cl)Cl.Cc1cc2c(-c3ccccc3)cccc2[cH-]1.
What is the InChIKey of dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide?
The InChIKey is PVXFVBLPXRECSN-UHFFFAOYSA-L. The full InChI is InChI=1S/C16H13.C2H6Si.2ClH.Zr/c1-12-10-14-8-5-9-15(16(14)11-12)13-6-3-2-4-7-13;1-3-2;;;/h2-11H,1H3;1-2H3;2*1H;/q-1;;;;+2/p-2.
What are the key properties of dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide?
dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide has a molecular weight of 425.57 g/mol, XLogP of 6.70, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro(dimethylsilylidene)zirconium;2-methyl-4-phenyl-1H-inden-1-ide is sourced from PubChem (CID 173167379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).