C21H31NO5S — CID 173167649
methyl sulfate;trimethyl-[3-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium (PubChem CID 173167649) has the molecular formula C21H31NO5S and a molecular weight of 409.55 g/mol. Its IUPAC name is methyl sulfate;trimethyl-[3-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium.
| Compound Name | methyl sulfate;trimethyl-[3-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium |
|---|---|
| PubChem CID | 173167649 |
| Molecular Formula | C21H31NO5S |
| Molecular Weight | 409.55 g/mol |
| Exact Mass | 409.19 |
| IUPAC Name | methyl sulfate;trimethyl-[3-[(4,7,7-trimethyl-3-oxo-2-bicyclo[2.2.1]heptanylidene)methyl]phenyl]azanium |
| SMILES | CC12CCC(C(=Cc3cccc([N+](C)(C)C)c3)C1=O)C2(C)C.COS(=O)(=O)[O-] |
| InChI | InChI=1S/C20H28NO.CH4O4S/c1-19(2)17-10-11-20(19,3)18(22)16(17)13-14-8-7-9-15(12-14)21(4,5)6;1-5-6(2,3)4/h7-9,12-13,17H,10-11H2,1-6H3;1H3,(H,2,3,4)/q+1;/p-1 |
| InChIKey | NBNFIXKOBZUMKM-UHFFFAOYSA-M |
| XLogP | 3.38 |
| TPSA | 83.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.55 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|