About (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane
(2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane (PubChem CID 173168074) has the molecular formula C16H20Si
and a molecular weight of 240.42 g/mol. Its IUPAC name is (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane.
Molecular Properties
| Compound Name | (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane |
| PubChem CID | 173168074 |
| Molecular Formula | C16H20Si |
| Molecular Weight | 240.42 g/mol |
| Exact Mass | 240.13 |
| IUPAC Name | (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane |
| SMILES | C#CC1=CC=CC(C#C)C1=[SiH]CCCCCC |
| InChI | InChI=1S/C16H20Si/c1-4-7-8-9-13-17-16-14(5-2)11-10-12-15(16)6-3/h2-3,10-12,14,17H,4,7-9,13H2,1H3 |
| InChIKey | BWOATWJZGUWHRA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.42 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane?
The IUPAC name of (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane (CID 173168074) is (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane.
What is the SMILES notation for (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane?
The canonical SMILES for (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane is C#CC1=CC=CC(C#C)C1=[SiH]CCCCCC.
What is the InChIKey of (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane?
The InChIKey is BWOATWJZGUWHRA-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20Si/c1-4-7-8-9-13-17-16-14(5-2)11-10-12-15(16)6-3/h2-3,10-12,14,17H,4,7-9,13H2,1H3.
What are the key properties of (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane?
(2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane has a molecular weight of 240.42 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2,6-diethynylcyclohexa-2,4-dien-1-ylidene)-hexylsilane is sourced from PubChem (CID 173168074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).