About (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane
(2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane (PubChem CID 173168244) has the molecular formula C10H12Si
and a molecular weight of 160.29 g/mol. Its IUPAC name is (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane.
Molecular Properties
| Compound Name | (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane |
| PubChem CID | 173168244 |
| Molecular Formula | C10H12Si |
| Molecular Weight | 160.29 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane |
| SMILES | C#CC1=CC=CCC1=[Si](C)C |
| InChI | InChI=1S/C10H12Si/c1-4-9-7-5-6-8-10(9)11(2)3/h1,5-7H,8H2,2-3H3 |
| InChIKey | IKKUIUJBPGSNJP-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.29 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane?
The IUPAC name of (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane (CID 173168244) is (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane.
What is the SMILES notation for (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane?
The canonical SMILES for (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane is C#CC1=CC=CCC1=[Si](C)C.
What is the InChIKey of (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane?
The InChIKey is IKKUIUJBPGSNJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12Si/c1-4-9-7-5-6-8-10(9)11(2)3/h1,5-7H,8H2,2-3H3.
What are the key properties of (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane?
(2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane has a molecular weight of 160.29 g/mol, XLogP of 2.01, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (2-ethynylcyclohexa-2,4-dien-1-ylidene)-dimethylsilane is sourced from PubChem (CID 173168244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).