C62H60N6 — CID 173170192
2,6-bis[2-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]ethenyl]-1,3,3,5,7,7-hexamethyl-2,6-dihydropyrrolo[2,3-f]indole (PubChem CID 173170192) has the molecular formula C62H60N6 and a molecular weight of 889.20 g/mol. Its IUPAC name is 2,6-bis[2-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]ethenyl]-1,3,3,5,7,7-hexamethyl-2,6-dihydropyrrolo[2,3-f]indole.
| Compound Name | 2,6-bis[2-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]ethenyl]-1,3,3,5,7,7-hexamethyl-2,6-dihydropyrrolo[2,3-f]indole |
|---|---|
| PubChem CID | 173170192 |
| Molecular Formula | C62H60N6 |
| Molecular Weight | 889.20 g/mol |
| Exact Mass | 888.49 |
| IUPAC Name | 2,6-bis[2-[4-(3,5-diphenyl-3,4-dihydropyrazol-2-yl)phenyl]ethenyl]-1,3,3,5,7,7-hexamethyl-2,6-dihydropyrrolo[2,3-f]indole |
| SMILES | CN1c2cc3c(cc2C(C)(C)C1C=Cc1ccc(N2N=C(c4ccccc4)CC2c2ccccc2)cc1)N(C)C(C=Cc1ccc(N2N=C(c4ccccc4)CC2c2ccccc2)cc1)C3(C)C |
| InChI | InChI=1S/C62H60N6/c1-61(2)51-39-58-52(40-57(51)65(5)59(61)37-31-43-27-33-49(34-28-43)67-55(47-23-15-9-16-24-47)41-53(63-67)45-19-11-7-12-20-45)62(3,4)60(66(58)6)38-32-44-29-35-50(36-30-44)68-56(48-25-17-10-18-26-48)42-54(64-68)46-21-13-8-14-22-46/h7-40,55-56,59-60H,41-42H2,1-6H3 |
| InChIKey | CWMTXFVZWZGABP-UHFFFAOYSA-N |
| XLogP | 14.02 |
| TPSA | 37.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 68 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 889.20 |
| LogP ≤ 5 | 14.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |