About [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid
[1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid (PubChem CID 173170429) has the molecular formula C7H6Br2N2O2S
and a molecular weight of 342.01 g/mol. Its IUPAC name is [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid.
Molecular Properties
| Compound Name | [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid |
| PubChem CID | 173170429 |
| Molecular Formula | C7H6Br2N2O2S |
| Molecular Weight | 342.01 g/mol |
| Exact Mass | 339.85 |
| IUPAC Name | [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid |
| SMILES | CC(=NNC(=O)O)c1sc(Br)cc1Br |
| InChI | InChI=1S/C7H6Br2N2O2S/c1-3(10-11-7(12)13)6-4(8)2-5(9)14-6/h2,11H,1H3,(H,12,13) |
| InChIKey | KZQJXXQZEDYSBS-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 61.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.01 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid?
The IUPAC name of [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid (CID 173170429) is [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid.
What is the SMILES notation for [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid?
The canonical SMILES for [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid is CC(=NNC(=O)O)c1sc(Br)cc1Br.
What is the InChIKey of [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid?
The InChIKey is KZQJXXQZEDYSBS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6Br2N2O2S/c1-3(10-11-7(12)13)6-4(8)2-5(9)14-6/h2,11H,1H3,(H,12,13).
What are the key properties of [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid?
[1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid has a molecular weight of 342.01 g/mol, XLogP of 3.26, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(3,5-dibromothiophen-2-yl)ethylideneamino]carbamic acid is sourced from PubChem (CID 173170429), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).