C3H7N5O — CID 173170502
N,N-bis(2-methylidenehydrazinyl)formamide (PubChem CID 173170502) has the molecular formula C3H7N5O and a molecular weight of 129.12 g/mol. Its IUPAC name is N,N-bis(2-methylidenehydrazinyl)formamide.
| Compound Name | N,N-bis(2-methylidenehydrazinyl)formamide |
|---|---|
| PubChem CID | 173170502 |
| Molecular Formula | C3H7N5O |
| Molecular Weight | 129.12 g/mol |
| Exact Mass | 129.07 |
| IUPAC Name | N,N-bis(2-methylidenehydrazinyl)formamide |
| SMILES | C=NNN(C=O)NN=C |
| InChI | InChI=1S/C3H7N5O/c1-4-6-8(3-9)7-5-2/h3,6-7H,1-2H2 |
| InChIKey | UTHHYSDXXSFOAR-UHFFFAOYSA-N |
| XLogP | -1.31 |
| TPSA | 69.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 129.12 |
| LogP ≤ 5 | -1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|