About 2-cyclopentyl-1,3-oxathiole
2-cyclopentyl-1,3-oxathiole (PubChem CID 173170521) has the molecular formula C8H12OS
and a molecular weight of 156.25 g/mol. Its IUPAC name is 2-cyclopentyl-1,3-oxathiole.
Molecular Properties
| Compound Name | 2-cyclopentyl-1,3-oxathiole |
| PubChem CID | 173170521 |
| Molecular Formula | C8H12OS |
| Molecular Weight | 156.25 g/mol |
| Exact Mass | 156.06 |
| IUPAC Name | 2-cyclopentyl-1,3-oxathiole |
| SMILES | C1=CSC(C2CCCC2)O1 |
| InChI | InChI=1S/C8H12OS/c1-2-4-7(3-1)8-9-5-6-10-8/h5-8H,1-4H2 |
| InChIKey | XDGVZHMNOGZLIG-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 156.25 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclopentyl-1,3-oxathiole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclopentyl-1,3-oxathiole?
The IUPAC name of 2-cyclopentyl-1,3-oxathiole (CID 173170521) is 2-cyclopentyl-1,3-oxathiole.
What is the SMILES notation for 2-cyclopentyl-1,3-oxathiole?
The canonical SMILES for 2-cyclopentyl-1,3-oxathiole is C1=CSC(C2CCCC2)O1.
What is the InChIKey of 2-cyclopentyl-1,3-oxathiole?
The InChIKey is XDGVZHMNOGZLIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12OS/c1-2-4-7(3-1)8-9-5-6-10-8/h5-8H,1-4H2.
What are the key properties of 2-cyclopentyl-1,3-oxathiole?
2-cyclopentyl-1,3-oxathiole has a molecular weight of 156.25 g/mol, XLogP of 2.74, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclopentyl-1,3-oxathiole is sourced from PubChem (CID 173170521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).