About lithium;hydride;2-prop-2-enyladamantan-2-ol
lithium;hydride;2-prop-2-enyladamantan-2-ol (PubChem CID 173172554) has the molecular formula C13H21LiO
and a molecular weight of 200.25 g/mol. Its IUPAC name is lithium;hydride;2-prop-2-enyladamantan-2-ol.
Molecular Properties
| Compound Name | lithium;hydride;2-prop-2-enyladamantan-2-ol |
| PubChem CID | 173172554 |
| Molecular Formula | C13H21LiO |
| Molecular Weight | 200.25 g/mol |
| Exact Mass | 200.18 |
| IUPAC Name | lithium;hydride;2-prop-2-enyladamantan-2-ol |
| SMILES | C=CCC1(O)C2CC3CC(C2)CC1C3.[H-].[Li+] |
| InChI | InChI=1S/C13H20O.Li.H/c1-2-3-13(14)11-5-9-4-10(7-11)8-12(13)6-9;;/h2,9-12,14H,1,3-8H2;;/q;+1;-1 |
| InChIKey | CAJONTGLSFTNMQ-UHFFFAOYSA-N |
| XLogP | -0.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.25 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze lithium;hydride;2-prop-2-enyladamantan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of lithium;hydride;2-prop-2-enyladamantan-2-ol?
The IUPAC name of lithium;hydride;2-prop-2-enyladamantan-2-ol (CID 173172554) is lithium;hydride;2-prop-2-enyladamantan-2-ol.
What is the SMILES notation for lithium;hydride;2-prop-2-enyladamantan-2-ol?
The canonical SMILES for lithium;hydride;2-prop-2-enyladamantan-2-ol is C=CCC1(O)C2CC3CC(C2)CC1C3.[H-].[Li+].
What is the InChIKey of lithium;hydride;2-prop-2-enyladamantan-2-ol?
The InChIKey is CAJONTGLSFTNMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O.Li.H/c1-2-3-13(14)11-5-9-4-10(7-11)8-12(13)6-9;;/h2,9-12,14H,1,3-8H2;;/q;+1;-1.
What are the key properties of lithium;hydride;2-prop-2-enyladamantan-2-ol?
lithium;hydride;2-prop-2-enyladamantan-2-ol has a molecular weight of 200.25 g/mol, XLogP of -0.13, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for lithium;hydride;2-prop-2-enyladamantan-2-ol is sourced from PubChem (CID 173172554), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).