C17H21NO7 — CID 173173062
1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2,3-dihydroxybutanedioic acid (PubChem CID 173173062) has the molecular formula C17H21NO7 and a molecular weight of 351.36 g/mol. Its IUPAC name is 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2,3-dihydroxybutanedioic acid.
| Compound Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2,3-dihydroxybutanedioic acid |
|---|---|
| PubChem CID | 173173062 |
| Molecular Formula | C17H21NO7 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 1,2,3,4,4a,5-hexahydrophenanthridin-2-ol;2,3-dihydroxybutanedioic acid |
| SMILES | O=C(O)C(O)C(O)C(=O)O.OC1CCC2NC=c3ccccc3=C2C1 |
| InChI | InChI=1S/C13H15NO.C4H6O6/c15-10-5-6-13-12(7-10)11-4-2-1-3-9(11)8-14-13;5-1(3(7)8)2(6)4(9)10/h1-4,8,10,13-15H,5-7H2;1-2,5-6H,(H,7,8)(H,9,10) |
| InChIKey | DYEUNECVAGBLPT-UHFFFAOYSA-N |
| XLogP | -2.03 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | -2.03 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |