About (4-butyl-1,3-thiazol-2-yl)methyl formate
(4-butyl-1,3-thiazol-2-yl)methyl formate (PubChem CID 173173521) has the molecular formula C9H13NO2S
and a molecular weight of 199.28 g/mol. Its IUPAC name is (4-butyl-1,3-thiazol-2-yl)methyl formate.
Molecular Properties
| Compound Name | (4-butyl-1,3-thiazol-2-yl)methyl formate |
| PubChem CID | 173173521 |
| Molecular Formula | C9H13NO2S |
| Molecular Weight | 199.28 g/mol |
| Exact Mass | 199.07 |
| IUPAC Name | (4-butyl-1,3-thiazol-2-yl)methyl formate |
| SMILES | CCCCc1csc(COC=O)n1 |
| InChI | InChI=1S/C9H13NO2S/c1-2-3-4-8-6-13-9(10-8)5-12-7-11/h6-7H,2-5H2,1H3 |
| InChIKey | YKAVOUVABZCDQY-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.28 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (4-butyl-1,3-thiazol-2-yl)methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-butyl-1,3-thiazol-2-yl)methyl formate?
The IUPAC name of (4-butyl-1,3-thiazol-2-yl)methyl formate (CID 173173521) is (4-butyl-1,3-thiazol-2-yl)methyl formate.
What is the SMILES notation for (4-butyl-1,3-thiazol-2-yl)methyl formate?
The canonical SMILES for (4-butyl-1,3-thiazol-2-yl)methyl formate is CCCCc1csc(COC=O)n1.
What is the InChIKey of (4-butyl-1,3-thiazol-2-yl)methyl formate?
The InChIKey is YKAVOUVABZCDQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H13NO2S/c1-2-3-4-8-6-13-9(10-8)5-12-7-11/h6-7H,2-5H2,1H3.
What are the key properties of (4-butyl-1,3-thiazol-2-yl)methyl formate?
(4-butyl-1,3-thiazol-2-yl)methyl formate has a molecular weight of 199.28 g/mol, XLogP of 2.16, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4-butyl-1,3-thiazol-2-yl)methyl formate is sourced from PubChem (CID 173173521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).