C14H14F5N3O2 — CID 173173614
4-(3-oxopropyl)-N-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carboxamide (PubChem CID 173173614) has the molecular formula C14H14F5N3O2 and a molecular weight of 351.28 g/mol. Its IUPAC name is 4-(3-oxopropyl)-N-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carboxamide.
| Compound Name | 4-(3-oxopropyl)-N-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carboxamide |
|---|---|
| PubChem CID | 173173614 |
| Molecular Formula | C14H14F5N3O2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.10 |
| IUPAC Name | 4-(3-oxopropyl)-N-(2,3,4,5,6-pentafluorophenyl)piperazine-1-carboxamide |
| SMILES | O=CCCN1CCN(C(=O)Nc2c(F)c(F)c(F)c(F)c2F)CC1 |
| InChI | InChI=1S/C14H14F5N3O2/c15-8-9(16)11(18)13(12(19)10(8)17)20-14(24)22-5-3-21(4-6-22)2-1-7-23/h7H,1-6H2,(H,20,24) |
| InChIKey | SJFKZHQLGATMKP-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|