C18H23NaO2 — CID 173174187
sodium;hydride;(8S,9R,13S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one (PubChem CID 173174187) has the molecular formula C18H23NaO2 and a molecular weight of 294.37 g/mol. Its IUPAC name is sodium;hydride;(8S,9R,13S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one.
| Compound Name | sodium;hydride;(8S,9R,13S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
|---|---|
| PubChem CID | 173174187 |
| Molecular Formula | C18H23NaO2 |
| Molecular Weight | 294.37 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | sodium;hydride;(8S,9R,13S)-3-hydroxy-13-methyl-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-17-one |
| SMILES | C[C@]12CC[C@H]3c4ccc(O)cc4CC[C@@H]3C1CCC2=O.[H-].[Na+] |
| InChI | InChI=1S/C18H22O2.Na.H/c1-18-9-8-14-13-5-3-12(19)10-11(13)2-4-15(14)16(18)6-7-17(18)20;;/h3,5,10,14-16,19H,2,4,6-9H2,1H3;;/q;+1;-1/t14-,15-,16?,18-;;/m0../s1 |
| InChIKey | HAPMRAQWUARUNW-AQZLLUFISA-N |
| XLogP | 0.93 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.37 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |