C15H30O3Si — CID 173174284
1-[3-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohex-3-en-1-yl]ethane-1,2-diol (PubChem CID 173174284) has the molecular formula C15H30O3Si and a molecular weight of 286.49 g/mol. Its IUPAC name is 1-[3-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohex-3-en-1-yl]ethane-1,2-diol.
| Compound Name | 1-[3-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohex-3-en-1-yl]ethane-1,2-diol |
|---|---|
| PubChem CID | 173174284 |
| Molecular Formula | C15H30O3Si |
| Molecular Weight | 286.49 g/mol |
| Exact Mass | 286.20 |
| IUPAC Name | 1-[3-(1-dimethylsilyloxy-2,2-dimethylpropyl)cyclohex-3-en-1-yl]ethane-1,2-diol |
| SMILES | C[SiH](C)OC(C1=CCCC(C(O)CO)C1)C(C)(C)C |
| InChI | InChI=1S/C15H30O3Si/c1-15(2,3)14(18-19(4)5)12-8-6-7-11(9-12)13(17)10-16/h8,11,13-14,16-17,19H,6-7,9-10H2,1-5H3 |
| InChIKey | ABJIOADWBUPOLS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.49 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|