About carbonic acid;copper;dihydrate
carbonic acid;copper;dihydrate (PubChem CID 173174362) has the molecular formula CH6CuO5
and a molecular weight of 161.60 g/mol. Its IUPAC name is carbonic acid;copper;dihydrate.
Molecular Properties
| Compound Name | carbonic acid;copper;dihydrate |
| PubChem CID | 173174362 |
| Molecular Formula | CH6CuO5 |
| Molecular Weight | 161.60 g/mol |
| Exact Mass | 160.95 |
| IUPAC Name | carbonic acid;copper;dihydrate |
| SMILES | O.O.O=C(O)O.[Cu] |
| InChI | InChI=1S/CH2O3.Cu.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2 |
| InChIKey | GIGBOXUENXPPIP-UHFFFAOYSA-N |
| XLogP | -1.43 |
| TPSA | 120.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 161.60 |
| LogP ≤ 5 | -1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze carbonic acid;copper;dihydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of carbonic acid;copper;dihydrate?
The IUPAC name of carbonic acid;copper;dihydrate (CID 173174362) is carbonic acid;copper;dihydrate.
What is the SMILES notation for carbonic acid;copper;dihydrate?
The canonical SMILES for carbonic acid;copper;dihydrate is O.O.O=C(O)O.[Cu].
What is the InChIKey of carbonic acid;copper;dihydrate?
The InChIKey is GIGBOXUENXPPIP-UHFFFAOYSA-N. The full InChI is InChI=1S/CH2O3.Cu.2H2O/c2-1(3)4;;;/h(H2,2,3,4);;2*1H2.
What are the key properties of carbonic acid;copper;dihydrate?
carbonic acid;copper;dihydrate has a molecular weight of 161.60 g/mol, XLogP of -1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for carbonic acid;copper;dihydrate is sourced from PubChem (CID 173174362), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).