About 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid
2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid (PubChem CID 173174602) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid.
Molecular Properties
| Compound Name | 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid |
| PubChem CID | 173174602 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid |
| SMILES | C=CC(C=C1OCCN1C)=C(C#N)C(=O)O |
| InChI | InChI=1S/C11H12N2O3/c1-3-8(9(7-12)11(14)15)6-10-13(2)4-5-16-10/h3,6H,1,4-5H2,2H3,(H,14,15) |
| InChIKey | AMYQHVFCOYZVSH-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 73.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid?
The IUPAC name of 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid (CID 173174602) is 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid.
What is the SMILES notation for 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid?
The canonical SMILES for 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid is C=CC(C=C1OCCN1C)=C(C#N)C(=O)O.
What is the InChIKey of 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid?
The InChIKey is AMYQHVFCOYZVSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12N2O3/c1-3-8(9(7-12)11(14)15)6-10-13(2)4-5-16-10/h3,6H,1,4-5H2,2H3,(H,14,15).
What are the key properties of 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid?
2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid has a molecular weight of 220.23 g/mol, XLogP of 0.88, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyano-3-[(3-methyl-1,3-oxazolidin-2-ylidene)methyl]penta-2,4-dienoic acid is sourced from PubChem (CID 173174602), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).