About 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene
1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene (PubChem CID 173174943) has the molecular formula C26H36
and a molecular weight of 348.57 g/mol. Its IUPAC name is 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene.
Molecular Properties
| Compound Name | 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene |
| PubChem CID | 173174943 |
| Molecular Formula | C26H36 |
| Molecular Weight | 348.57 g/mol |
| Exact Mass | 348.28 |
| IUPAC Name | 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene |
| SMILES | C=C(c1cc(C(C)C)cc(C(C)C)c1)c1cc(C(C)C)cc(C(C)C)c1 |
| InChI | InChI=1S/C26H36/c1-16(2)21-10-22(17(3)4)13-25(12-21)20(9)26-14-23(18(5)6)11-24(15-26)19(7)8/h10-19H,9H2,1-8H3 |
| InChIKey | IVBOFIOFRMPYET-UHFFFAOYSA-N |
| XLogP | 8.24 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 348.57 |
| LogP ≤ 5 | 8.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene?
The IUPAC name of 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene (CID 173174943) is 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene.
What is the SMILES notation for 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene?
The canonical SMILES for 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene is C=C(c1cc(C(C)C)cc(C(C)C)c1)c1cc(C(C)C)cc(C(C)C)c1.
What is the InChIKey of 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene?
The InChIKey is IVBOFIOFRMPYET-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H36/c1-16(2)21-10-22(17(3)4)13-25(12-21)20(9)26-14-23(18(5)6)11-24(15-26)19(7)8/h10-19H,9H2,1-8H3.
What are the key properties of 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene?
1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene has a molecular weight of 348.57 g/mol, XLogP of 8.24, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[1-[3,5-di(propan-2-yl)phenyl]ethenyl]-3,5-di(propan-2-yl)benzene is sourced from PubChem (CID 173174943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).