About 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione
4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione (PubChem CID 173175416) has the molecular formula C8H5N3S2
and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione.
Molecular Properties
| Compound Name | 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione |
| PubChem CID | 173175416 |
| Molecular Formula | C8H5N3S2 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 206.99 |
| IUPAC Name | 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione |
| SMILES | S=C1C=CC(c2cn[nH]n2)=CC1=S |
| InChI | InChI=1S/C8H5N3S2/c12-7-2-1-5(3-8(7)13)6-4-9-11-10-6/h1-4H,(H,9,10,11) |
| InChIKey | MPASNZWENDPMPK-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione?
The IUPAC name of 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione (CID 173175416) is 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione.
What is the SMILES notation for 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione?
The canonical SMILES for 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione is S=C1C=CC(c2cn[nH]n2)=CC1=S.
What is the InChIKey of 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione?
The InChIKey is MPASNZWENDPMPK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H5N3S2/c12-7-2-1-5(3-8(7)13)6-4-9-11-10-6/h1-4H,(H,9,10,11).
What are the key properties of 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione?
4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione has a molecular weight of 207.28 g/mol, XLogP of 1.50, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(2H-triazol-4-yl)cyclohexa-3,5-diene-1,2-dithione is sourced from PubChem (CID 173175416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).