C11H13N — CID 173177075
3,3a,4,8,8a,8b-hexahydrocyclopenta[b]indole (PubChem CID 173177075) has the molecular formula C11H13N and a molecular weight of 159.23 g/mol. Its IUPAC name is 3,3a,4,8,8a,8b-hexahydrocyclopenta[b]indole.
| Compound Name | 3,3a,4,8,8a,8b-hexahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 173177075 |
| Molecular Formula | C11H13N |
| Molecular Weight | 159.23 g/mol |
| Exact Mass | 159.10 |
| IUPAC Name | 3,3a,4,8,8a,8b-hexahydrocyclopenta[b]indole |
| SMILES | C1=CCC2C(=C1)NC1CC=CC12 |
| InChI | InChI=1S/C11H13N/c1-2-6-10-8(4-1)9-5-3-7-11(9)12-10/h1-3,5-6,8-9,11-12H,4,7H2 |
| InChIKey | MLPKFPCAAVPUMN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 159.23 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|