C18H17N — CID 173177356
8-(4-methylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole (PubChem CID 173177356) has the molecular formula C18H17N and a molecular weight of 247.34 g/mol. Its IUPAC name is 8-(4-methylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole.
| Compound Name | 8-(4-methylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
|---|---|
| PubChem CID | 173177356 |
| Molecular Formula | C18H17N |
| Molecular Weight | 247.34 g/mol |
| Exact Mass | 247.14 |
| IUPAC Name | 8-(4-methylphenyl)-1,2,3,4-tetrahydrocyclopenta[b]indole |
| SMILES | Cc1ccc(-c2cccc3[nH]c4c(c23)CCC4)cc1 |
| InChI | InChI=1S/C18H17N/c1-12-8-10-13(11-9-12)14-4-2-7-17-18(14)15-5-3-6-16(15)19-17/h2,4,7-11,19H,3,5-6H2,1H3 |
| InChIKey | BFYGIYICEXJKKM-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.34 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |