About O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate
O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate (PubChem CID 173177445) has the molecular formula C21H21N3OS
and a molecular weight of 363.49 g/mol. Its IUPAC name is O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate.
Molecular Properties
| Compound Name | O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate |
| PubChem CID | 173177445 |
| Molecular Formula | C21H21N3OS |
| Molecular Weight | 363.49 g/mol |
| Exact Mass | 363.14 |
| IUPAC Name | O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate |
| SMILES | Cc1ccc(CN(C(=S)OCc2cccnc2)c2ccccc2N)cc1 |
| InChI | InChI=1S/C21H21N3OS/c1-16-8-10-17(11-9-16)14-24(20-7-3-2-6-19(20)22)21(26)25-15-18-5-4-12-23-13-18/h2-13H,14-15,22H2,1H3 |
| InChIKey | OILABMOEFASBIF-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 363.49 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate?
The IUPAC name of O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate (CID 173177445) is O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate.
What is the SMILES notation for O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate?
The canonical SMILES for O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate is Cc1ccc(CN(C(=S)OCc2cccnc2)c2ccccc2N)cc1.
What is the InChIKey of O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate?
The InChIKey is OILABMOEFASBIF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21N3OS/c1-16-8-10-17(11-9-16)14-24(20-7-3-2-6-19(20)22)21(26)25-15-18-5-4-12-23-13-18/h2-13H,14-15,22H2,1H3.
What are the key properties of O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate?
O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate has a molecular weight of 363.49 g/mol, XLogP of 4.48, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for O-(pyridin-3-ylmethyl) N-(2-aminophenyl)-N-[(4-methylphenyl)methyl]carbamothioate is sourced from PubChem (CID 173177445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).