About N,N-bis(prop-2-enyl)propan-1-amine;nitric acid
N,N-bis(prop-2-enyl)propan-1-amine;nitric acid (PubChem CID 173177521) has the molecular formula C9H18N2O3
and a molecular weight of 202.25 g/mol. Its IUPAC name is N,N-bis(prop-2-enyl)propan-1-amine;nitric acid.
Molecular Properties
| Compound Name | N,N-bis(prop-2-enyl)propan-1-amine;nitric acid |
| PubChem CID | 173177521 |
| Molecular Formula | C9H18N2O3 |
| Molecular Weight | 202.25 g/mol |
| Exact Mass | 202.13 |
| IUPAC Name | N,N-bis(prop-2-enyl)propan-1-amine;nitric acid |
| SMILES | C=CCN(CC=C)CCC.O=[N+]([O-])O |
| InChI | InChI=1S/C9H17N.HNO3/c1-4-7-10(8-5-2)9-6-3;2-1(3)4/h4-5H,1-2,6-9H2,3H3;(H,2,3,4) |
| InChIKey | HGNFHJCZDVPPMN-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.25 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N,N-bis(prop-2-enyl)propan-1-amine;nitric acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,N-bis(prop-2-enyl)propan-1-amine;nitric acid?
The IUPAC name of N,N-bis(prop-2-enyl)propan-1-amine;nitric acid (CID 173177521) is N,N-bis(prop-2-enyl)propan-1-amine;nitric acid.
What is the SMILES notation for N,N-bis(prop-2-enyl)propan-1-amine;nitric acid?
The canonical SMILES for N,N-bis(prop-2-enyl)propan-1-amine;nitric acid is C=CCN(CC=C)CCC.O=[N+]([O-])O.
What is the InChIKey of N,N-bis(prop-2-enyl)propan-1-amine;nitric acid?
The InChIKey is HGNFHJCZDVPPMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17N.HNO3/c1-4-7-10(8-5-2)9-6-3;2-1(3)4/h4-5H,1-2,6-9H2,3H3;(H,2,3,4).
What are the key properties of N,N-bis(prop-2-enyl)propan-1-amine;nitric acid?
N,N-bis(prop-2-enyl)propan-1-amine;nitric acid has a molecular weight of 202.25 g/mol, XLogP of 1.72, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N,N-bis(prop-2-enyl)propan-1-amine;nitric acid is sourced from PubChem (CID 173177521), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).