C43H24B4F20O12 — CID 173177693
benzhydrylbenzene;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) (PubChem CID 173177693) has the molecular formula C43H24B4F20O12 and a molecular weight of 1155.86 g/mol. Its IUPAC name is benzhydrylbenzene;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid).
| Compound Name | benzhydrylbenzene;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) |
|---|---|
| PubChem CID | 173177693 |
| Molecular Formula | C43H24B4F20O12 |
| Molecular Weight | 1155.86 g/mol |
| Exact Mass | 1156.13 |
| IUPAC Name | benzhydrylbenzene;tetrakis((2,3,4,5,6-pentafluorophenoxy)boronic acid) |
| SMILES | OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.OB(O)Oc1c(F)c(F)c(F)c(F)c1F.c1ccc(C(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C19H16.4C6H2BF5O3/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;4*8-1-2(9)4(11)6(15-7(13)14)5(12)3(1)10/h1-15,19H;4*13-14H |
| InChIKey | NKIKTLJKUHRMJE-UHFFFAOYSA-N |
| XLogP | 7.79 |
| TPSA | 198.76 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 79 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1155.86 |
| LogP ≤ 5 | 7.79 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|