C12H19NO4 — CID 173177710
3-(4-hydroxyphenyl)-2-methoxypropanoic acid;N-methylmethanamine (PubChem CID 173177710) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is 3-(4-hydroxyphenyl)-2-methoxypropanoic acid;N-methylmethanamine.
| Compound Name | 3-(4-hydroxyphenyl)-2-methoxypropanoic acid;N-methylmethanamine |
|---|---|
| PubChem CID | 173177710 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | 3-(4-hydroxyphenyl)-2-methoxypropanoic acid;N-methylmethanamine |
| SMILES | CNC.COC(Cc1ccc(O)cc1)C(=O)O |
| InChI | InChI=1S/C10H12O4.C2H7N/c1-14-9(10(12)13)6-7-2-4-8(11)5-3-7;1-3-2/h2-5,9,11H,6H2,1H3,(H,12,13);3H,1-2H3 |
| InChIKey | WNYAADYDOREETB-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |