About dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide
dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide (PubChem CID 173179166) has the molecular formula C17H17Cl2SiZr-
and a molecular weight of 411.54 g/mol. Its IUPAC name is dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide.
Molecular Properties
| Compound Name | dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide |
| PubChem CID | 173179166 |
| Molecular Formula | C17H17Cl2SiZr- |
| Molecular Weight | 411.54 g/mol |
| Exact Mass | 408.95 |
| IUPAC Name | dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide |
| SMILES | C[Si](c1ccccc1)=[Zr](Cl)Cl.Cc1cc2ccccc2[cH-]1 |
| InChI | InChI=1S/C10H9.C7H8Si.2ClH.Zr/c1-8-6-9-4-2-3-5-10(9)7-8;1-8-7-5-3-2-4-6-7;;;/h2-7H,1H3;2-6H,1H3;2*1H;/q-1;;;;+2/p-2 |
| InChIKey | CCIUAUQZDDRXJX-UHFFFAOYSA-L |
| XLogP | 5.31 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 411.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide?
The IUPAC name of dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide (CID 173179166) is dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide.
What is the SMILES notation for dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide?
The canonical SMILES for dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide is C[Si](c1ccccc1)=[Zr](Cl)Cl.Cc1cc2ccccc2[cH-]1.
What is the InChIKey of dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide?
The InChIKey is CCIUAUQZDDRXJX-UHFFFAOYSA-L. The full InChI is InChI=1S/C10H9.C7H8Si.2ClH.Zr/c1-8-6-9-4-2-3-5-10(9)7-8;1-8-7-5-3-2-4-6-7;;;/h2-7H,1H3;2-6H,1H3;2*1H;/q-1;;;;+2/p-2.
What are the key properties of dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide?
dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide has a molecular weight of 411.54 g/mol, XLogP of 5.31, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dichloro-[methyl(phenyl)silylidene]zirconium;2-methyl-1H-inden-1-ide is sourced from PubChem (CID 173179166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).